C21H20N4O2S — CID 22580133
2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-1-prop-2-enylpyrido[2,3-d]pyrimidin-4-one (PubChem CID 22580133) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-1-prop-2-enylpyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-1-prop-2-enylpyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22580133 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-1-prop-2-enylpyrido[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)N2CCCc3ccccc32)nc(=O)c2cccnc21 |
| InChI | InChI=1S/C21H20N4O2S/c1-2-12-25-19-16(9-5-11-22-19)20(27)23-21(25)28-14-18(26)24-13-6-8-15-7-3-4-10-17(15)24/h2-5,7,9-11H,1,6,8,12-14H2 |
| InChIKey | XXTPMJGHBYPOHI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|