C21H27N3O2 — CID 22581206
methyl 1-(4-piperidin-1-ylpiperidin-1-yl)isoquinoline-4-carboxylate (PubChem CID 22581206) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is methyl 1-(4-piperidin-1-ylpiperidin-1-yl)isoquinoline-4-carboxylate.
| Compound Name | methyl 1-(4-piperidin-1-ylpiperidin-1-yl)isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 22581206 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | methyl 1-(4-piperidin-1-ylpiperidin-1-yl)isoquinoline-4-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCC(N3CCCCC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C21H27N3O2/c1-26-21(25)19-15-22-20(18-8-4-3-7-17(18)19)24-13-9-16(10-14-24)23-11-5-2-6-12-23/h3-4,7-8,15-16H,2,5-6,9-14H2,1H3 |
| InChIKey | DEDMLEHHVXXITM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |