C17H19N3O3 — CID 22330783
methyl 1-(4-carbamoylpiperidin-1-yl)isoquinoline-4-carboxylate (PubChem CID 22330783) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 1-(4-carbamoylpiperidin-1-yl)isoquinoline-4-carboxylate.
| Compound Name | methyl 1-(4-carbamoylpiperidin-1-yl)isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 22330783 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | methyl 1-(4-carbamoylpiperidin-1-yl)isoquinoline-4-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCC(C(N)=O)CC2)c2ccccc12 |
| InChI | InChI=1S/C17H19N3O3/c1-23-17(22)14-10-19-16(13-5-3-2-4-12(13)14)20-8-6-11(7-9-20)15(18)21/h2-5,10-11H,6-9H2,1H3,(H2,18,21) |
| InChIKey | ZROUPJBOHNNPDH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |