C19H24N2O2 — CID 126476831
methyl 1-[(2,3-dimethylcyclohexyl)amino]isoquinoline-4-carboxylate (PubChem CID 126476831) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 1-[(2,3-dimethylcyclohexyl)amino]isoquinoline-4-carboxylate.
| Compound Name | methyl 1-[(2,3-dimethylcyclohexyl)amino]isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 126476831 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | methyl 1-[(2,3-dimethylcyclohexyl)amino]isoquinoline-4-carboxylate |
| SMILES | COC(=O)c1cnc(NC2CCCC(C)C2C)c2ccccc12 |
| InChI | InChI=1S/C19H24N2O2/c1-12-7-6-10-17(13(12)2)21-18-15-9-5-4-8-14(15)16(11-20-18)19(22)23-3/h4-5,8-9,11-13,17H,6-7,10H2,1-3H3,(H,20,21) |
| InChIKey | WTVQYBGLIIDOEV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |