C23H18N4O3S — CID 22585584
3-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 22585584) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 22585584 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(-c3cccc(C(=O)NCc4ccco4)c3)cnc12 |
| InChI | InChI=1S/C23H18N4O3S/c1-13-9-14(2)26-22-18(13)19-20(31-22)23(29)27(12-25-19)16-6-3-5-15(10-16)21(28)24-11-17-7-4-8-30-17/h3-10,12H,11H2,1-2H3,(H,24,28) |
| InChIKey | GAGJTBWAACUUMT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |