C23H32N4O6S — CID 22586150
ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfamoyl]-1,2,5-trimethylpyrrole-3-carboxylate (PubChem CID 22586150) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfamoyl]-1,2,5-trimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfamoyl]-1,2,5-trimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 22586150 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfamoyl]-1,2,5-trimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(S(=O)(=O)NCC(=O)N2CCN(c3ccc(OC)cc3)CC2)c(C)n(C)c1C |
| InChI | InChI=1S/C23H32N4O6S/c1-6-33-23(29)21-16(2)25(4)17(3)22(21)34(30,31)24-15-20(28)27-13-11-26(12-14-27)18-7-9-19(32-5)10-8-18/h7-10,24H,6,11-15H2,1-5H3 |
| InChIKey | VAPJNXJARFYMJO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|