C28H28FN3O3S2 — CID 22589887
6-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(2-phenylethyl)hexanamide (PubChem CID 22589887) has the molecular formula C28H28FN3O3S2 and a molecular weight of 537.68 g/mol. Its IUPAC name is 6-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(2-phenylethyl)hexanamide.
| Compound Name | 6-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 22589887 |
| Molecular Formula | C28H28FN3O3S2 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 6-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(2-phenylethyl)hexanamide |
| SMILES | O=C(CCCCCn1c(SCC(=O)c2ccc(F)cc2)nc2ccsc2c1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H28FN3O3S2/c29-22-12-10-21(11-13-22)24(33)19-37-28-31-23-15-18-36-26(23)27(35)32(28)17-6-2-5-9-25(34)30-16-14-20-7-3-1-4-8-20/h1,3-4,7-8,10-13,15,18H,2,5-6,9,14,16-17,19H2,(H,30,34) |
| InChIKey | ULZSYRWVKLMBOG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|