C24H34ClN3O2 — CID 22596048
3-chloro-N-[6-ethyl-4-[ethyl(propyl)amino]-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]propanamide (PubChem CID 22596048) has the molecular formula C24H34ClN3O2 and a molecular weight of 432.01 g/mol. Its IUPAC name is 3-chloro-N-[6-ethyl-4-[ethyl(propyl)amino]-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]propanamide.
| Compound Name | 3-chloro-N-[6-ethyl-4-[ethyl(propyl)amino]-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 22596048 |
| Molecular Formula | C24H34ClN3O2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-chloro-N-[6-ethyl-4-[ethyl(propyl)amino]-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]propanamide |
| SMILES | CCCN(CC)c1cc(CC)nc(Oc2c(C)cc(C)cc2C)c1NC(=O)CCCl |
| InChI | InChI=1S/C24H34ClN3O2/c1-7-12-28(9-3)20-15-19(8-2)26-24(22(20)27-21(29)10-11-25)30-23-17(5)13-16(4)14-18(23)6/h13-15H,7-12H2,1-6H3,(H,27,29) |
| InChIKey | KZSQLWCDBSDPQJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|