C18H30N2O2 — CID 20522202
3-(dipropylamino)-N-(2-methoxy-4,6-dimethylphenyl)propanamide (PubChem CID 20522202) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-(dipropylamino)-N-(2-methoxy-4,6-dimethylphenyl)propanamide.
| Compound Name | 3-(dipropylamino)-N-(2-methoxy-4,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 20522202 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-(dipropylamino)-N-(2-methoxy-4,6-dimethylphenyl)propanamide |
| SMILES | CCCN(CCC)CCC(=O)Nc1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C18H30N2O2/c1-6-9-20(10-7-2)11-8-17(21)19-18-15(4)12-14(3)13-16(18)22-5/h12-13H,6-11H2,1-5H3,(H,19,21) |
| InChIKey | BOHBBUAYFRDLCD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |