C24H18ClN5O4S — CID 22596321
N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]pyridine-3-carboxamide (PubChem CID 22596321) has the molecular formula C24H18ClN5O4S and a molecular weight of 507.96 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]pyridine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22596321 |
| Molecular Formula | C24H18ClN5O4S |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(C(=O)Nc2ncccc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C24H18ClN5O4S/c25-17-11-12-21(28-14-17)29-24(32)19-5-3-13-27-22(19)30-23(31)16-9-7-15(8-10-16)18-4-1-2-6-20(18)35(26,33)34/h1-14H,(H2,26,33,34)(H,27,30,31)(H,28,29,32) |
| InChIKey | NRYPQCIFWFTPKX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |