C23H17ClN4O4S — CID 24794406
N-[2-[(5-chloro-2-pyridinyl)sulfamoyl]phenyl]-4-(2-oxo-1-pyridinyl)benzamide (PubChem CID 24794406) has the molecular formula C23H17ClN4O4S and a molecular weight of 480.93 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)sulfamoyl]phenyl]-4-(2-oxo-1-pyridinyl)benzamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)sulfamoyl]phenyl]-4-(2-oxo-1-pyridinyl)benzamide |
|---|---|
| PubChem CID | 24794406 |
| Molecular Formula | C23H17ClN4O4S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)sulfamoyl]phenyl]-4-(2-oxo-1-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)Nc1ccc(Cl)cn1)c1ccc(-n2ccccc2=O)cc1 |
| InChI | InChI=1S/C23H17ClN4O4S/c24-17-10-13-21(25-15-17)27-33(31,32)20-6-2-1-5-19(20)26-23(30)16-8-11-18(12-9-16)28-14-4-3-7-22(28)29/h1-15H,(H,25,27)(H,26,30) |
| InChIKey | MIJGLXFQYBTIFY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |