C18H13Cl2N3O3S — CID 1078173
2,4-dichloro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 1078173) has the molecular formula C18H13Cl2N3O3S and a molecular weight of 422.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1078173 |
| Molecular Formula | C18H13Cl2N3O3S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 2,4-dichloro-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O3S/c19-12-4-9-15(16(20)11-12)18(24)22-13-5-7-14(8-6-13)27(25,26)23-17-3-1-2-10-21-17/h1-11H,(H,21,23)(H,22,24) |
| InChIKey | SXDWQZCRILDHPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |