C28H34FN3O2 — CID 22599957
1-(2-amino-4,6-dimethylphenoxy)-3-[4-[4-[(4-fluorophenyl)methyl]phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 22599957) has the molecular formula C28H34FN3O2 and a molecular weight of 463.60 g/mol. Its IUPAC name is 1-(2-amino-4,6-dimethylphenoxy)-3-[4-[4-[(4-fluorophenyl)methyl]phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(2-amino-4,6-dimethylphenoxy)-3-[4-[4-[(4-fluorophenyl)methyl]phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 22599957 |
| Molecular Formula | C28H34FN3O2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 1-(2-amino-4,6-dimethylphenoxy)-3-[4-[4-[(4-fluorophenyl)methyl]phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cc(C)c(OCC(O)CN2CCN(c3ccc(Cc4ccc(F)cc4)cc3)CC2)c(N)c1 |
| InChI | InChI=1S/C28H34FN3O2/c1-20-15-21(2)28(27(30)16-20)34-19-26(33)18-31-11-13-32(14-12-31)25-9-5-23(6-10-25)17-22-3-7-24(29)8-4-22/h3-10,15-16,26,33H,11-14,17-19,30H2,1-2H3 |
| InChIKey | NMCQRXHRBRIOLQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|