C37H28N2O4 — CID 22600957
3-(3-hydroxy-N-[7-(3-hydroxy-N-(3-hydroxyphenyl)anilino)-9H-fluoren-2-yl]anilino)phenol (PubChem CID 22600957) has the molecular formula C37H28N2O4 and a molecular weight of 564.64 g/mol. Its IUPAC name is 3-(3-hydroxy-N-[7-(3-hydroxy-N-(3-hydroxyphenyl)anilino)-9H-fluoren-2-yl]anilino)phenol.
| Compound Name | 3-(3-hydroxy-N-[7-(3-hydroxy-N-(3-hydroxyphenyl)anilino)-9H-fluoren-2-yl]anilino)phenol |
|---|---|
| PubChem CID | 22600957 |
| Molecular Formula | C37H28N2O4 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 3-(3-hydroxy-N-[7-(3-hydroxy-N-(3-hydroxyphenyl)anilino)-9H-fluoren-2-yl]anilino)phenol |
| SMILES | Oc1cccc(N(c2cccc(O)c2)c2ccc3c(c2)Cc2cc(N(c4cccc(O)c4)c4cccc(O)c4)ccc2-3)c1 |
| InChI | InChI=1S/C37H28N2O4/c40-32-9-1-5-26(20-32)38(27-6-2-10-33(41)21-27)30-13-15-36-24(18-30)17-25-19-31(14-16-37(25)36)39(28-7-3-11-34(42)22-28)29-8-4-12-35(43)23-29/h1-16,18-23,40-43H,17H2 |
| InChIKey | WDWVTSUZPMHULV-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |