About 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride
7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride (PubChem CID 22601070) has the molecular formula C20H16Cl2Zr
and a molecular weight of 418.48 g/mol. Its IUPAC name is 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride.
Molecular Properties
| Compound Name | 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride |
| PubChem CID | 22601070 |
| Molecular Formula | C20H16Cl2Zr |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride |
| SMILES | [Cl-].[Cl-].[Zr+4].c1cc(CCc2cccc3cc[cH-]c23)c2[cH-]ccc2c1 |
| InChI | InChI=1S/C20H16.2ClH.Zr/c1-5-15-9-3-11-19(15)17(7-1)13-14-18-8-2-6-16-10-4-12-20(16)18;;;/h1-12H,13-14H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | PTJKKXPIPSZQQK-UHFFFAOYSA-L |
| XLogP | -0.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride?
The IUPAC name of 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride (CID 22601070) is 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride.
What is the SMILES notation for 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride?
The canonical SMILES for 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride is [Cl-].[Cl-].[Zr+4].c1cc(CCc2cccc3cc[cH-]c23)c2[cH-]ccc2c1.
What is the InChIKey of 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride?
The InChIKey is PTJKKXPIPSZQQK-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H16.2ClH.Zr/c1-5-15-9-3-11-19(15)17(7-1)13-14-18-8-2-6-16-10-4-12-20(16)18;;;/h1-12H,13-14H2;2*1H;/q-2;;;+4/p-2.
What are the key properties of 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride?
7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride has a molecular weight of 418.48 g/mol, XLogP of -0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(3H-inden-3-id-4-yl)ethyl]-1H-inden-1-ide;zirconium(4+);dichloride is sourced from PubChem (CID 22601070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).