C19H21ClN2S — CID 22603053
N-[4-(1-chloro-2-ethylbutyl)phenyl]-1,3-benzothiazol-2-amine (PubChem CID 22603053) has the molecular formula C19H21ClN2S and a molecular weight of 344.91 g/mol. Its IUPAC name is N-[4-(1-chloro-2-ethylbutyl)phenyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[4-(1-chloro-2-ethylbutyl)phenyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 22603053 |
| Molecular Formula | C19H21ClN2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[4-(1-chloro-2-ethylbutyl)phenyl]-1,3-benzothiazol-2-amine |
| SMILES | CCC(CC)C(Cl)c1ccc(Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H21ClN2S/c1-3-13(4-2)18(20)14-9-11-15(12-10-14)21-19-22-16-7-5-6-8-17(16)23-19/h5-13,18H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | GMZWNUOAEXUXHC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|