C19H27FNO+ — CID 2261130
2-(3-fluorophenyl)ethyl-[(2R)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium (PubChem CID 2261130) has the molecular formula C19H27FNO+ and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(3-fluorophenyl)ethyl-[(2R)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium.
| Compound Name | 2-(3-fluorophenyl)ethyl-[(2R)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium |
|---|---|
| PubChem CID | 2261130 |
| Molecular Formula | C19H27FNO+ |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 2-(3-fluorophenyl)ethyl-[(2R)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium |
| SMILES | Cc1ccc(C(C)(C)C[C@@H](C)[NH2+]CCc2cccc(F)c2)o1 |
| InChI | InChI=1S/C19H26FNO/c1-14(13-19(3,4)18-9-8-15(2)22-18)21-11-10-16-6-5-7-17(20)12-16/h5-9,12,14,21H,10-11,13H2,1-4H3/p+1/t14-/m1/s1 |
| InChIKey | UHIHTYFLLFIMGT-CQSZACIVSA-O |
| XLogP | 3.59 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |