C18H25FNO+ — CID 7463397
(4-fluorophenyl)methyl-[(2S)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium (PubChem CID 7463397) has the molecular formula C18H25FNO+ and a molecular weight of 290.40 g/mol. Its IUPAC name is (4-fluorophenyl)methyl-[(2S)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium.
| Compound Name | (4-fluorophenyl)methyl-[(2S)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium |
|---|---|
| PubChem CID | 7463397 |
| Molecular Formula | C18H25FNO+ |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (4-fluorophenyl)methyl-[(2S)-4-methyl-4-(5-methylfuran-2-yl)pentan-2-yl]azanium |
| SMILES | Cc1ccc(C(C)(C)C[C@H](C)[NH2+]Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H24FNO/c1-13(20-12-15-6-8-16(19)9-7-15)11-18(3,4)17-10-5-14(2)21-17/h5-10,13,20H,11-12H2,1-4H3/p+1/t13-/m0/s1 |
| InChIKey | HSHPVFMBIHEUDT-ZDUSSCGKSA-O |
| XLogP | 3.55 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |