C17H21FNO3S+ — CID 7288006
[(2R)-butan-2-yl]-[[4-(4-fluorophenyl)sulfonyloxyphenyl]methyl]azanium (PubChem CID 7288006) has the molecular formula C17H21FNO3S+ and a molecular weight of 338.42 g/mol. Its IUPAC name is [(2R)-butan-2-yl]-[[4-(4-fluorophenyl)sulfonyloxyphenyl]methyl]azanium.
| Compound Name | [(2R)-butan-2-yl]-[[4-(4-fluorophenyl)sulfonyloxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 7288006 |
| Molecular Formula | C17H21FNO3S+ |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(2R)-butan-2-yl]-[[4-(4-fluorophenyl)sulfonyloxyphenyl]methyl]azanium |
| SMILES | CC[C@@H](C)[NH2+]Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H20FNO3S/c1-3-13(2)19-12-14-4-8-16(9-5-14)22-23(20,21)17-10-6-15(18)7-11-17/h4-11,13,19H,3,12H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | WGHZWTWGJSYGFC-CYBMUJFWSA-O |
| XLogP | 2.46 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|