methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate

C14H16O2 — CID 22620535

IUPACmethyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate
SMILESCOC(=O)C1=Cc2ccccc2CC(C)C1
InChIInChI=1S/C14H16O2/c1-10-7-11-5-3-4-6-12(11)9-13(8-10)14(15)16-2/h3-6,9-10H,7-8H2,1-2H3
InChIKeyWQFLFPICAGXBCW-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.83
Rot. Bonds1

About methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate

methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate (PubChem CID 22620535) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate.

Molecular Properties

Compound Namemethyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate
PubChem CID22620535
Molecular FormulaC14H16O2
Molecular Weight216.28 g/mol
Exact Mass216.12
IUPAC Namemethyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate
SMILESCOC(=O)C1=Cc2ccccc2CC(C)C1
InChIInChI=1S/C14H16O2/c1-10-7-11-5-3-4-6-12(11)9-13(8-10)14(15)16-2/h3-6,9-10H,7-8H2,1-2H3
InChIKeyWQFLFPICAGXBCW-UHFFFAOYSA-N
XLogP2.83
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate?
The IUPAC name of methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate (CID 22620535) is methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate.
What is the SMILES notation for methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate?
The canonical SMILES for methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate is COC(=O)C1=Cc2ccccc2CC(C)C1.
What is the InChIKey of methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate?
The InChIKey is WQFLFPICAGXBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-10-7-11-5-3-4-6-12(11)9-13(8-10)14(15)16-2/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate?
methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate has a molecular weight of 216.28 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate is sourced from PubChem (CID 22620535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).