C22H26ClN3O4S — CID 22622732
(E)-2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-(2-methylbutan-2-ylamino)prop-2-enenitrile (PubChem CID 22622732) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-(2-methylbutan-2-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-(2-methylbutan-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 22622732 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-(2-methylbutan-2-ylamino)prop-2-enenitrile |
| SMILES | CCC(C)(C)N/C(Nc1cc(OC)cc(OC)c1)=C(/C#N)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3O4S/c1-6-22(2,3)26-21(25-16-11-17(29-4)13-18(12-16)30-5)20(14-24)31(27,28)19-9-7-15(23)8-10-19/h7-13,25-26H,6H2,1-5H3/b21-20- |
| InChIKey | WBYFNUHLWLFMJK-MRCUWXFGSA-N |
| XLogP | 4.71 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|