C18H17ClN2O4S2 — CID 70150368
2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-methylsulfanylprop-2-enenitrile (PubChem CID 70150368) has the molecular formula C18H17ClN2O4S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-methylsulfanylprop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-methylsulfanylprop-2-enenitrile |
|---|---|
| PubChem CID | 70150368 |
| Molecular Formula | C18H17ClN2O4S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-(3,5-dimethoxyanilino)-3-methylsulfanylprop-2-enenitrile |
| SMILES | COc1cc(NC(SC)=C(C#N)S(=O)(=O)c2ccc(Cl)cc2)cc(OC)c1 |
| InChI | InChI=1S/C18H17ClN2O4S2/c1-24-14-8-13(9-15(10-14)25-2)21-18(26-3)17(11-20)27(22,23)16-6-4-12(19)5-7-16/h4-10,21H,1-3H3 |
| InChIKey | NCTUXUYXYPDHAK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|