C24H28N2O3S — CID 22623214
tert-butyl N-[2,3-dihydro-1H-inden-2-yl-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]carbamate (PubChem CID 22623214) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydro-1H-inden-2-yl-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydro-1H-inden-2-yl-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]carbamate |
|---|---|
| PubChem CID | 22623214 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | tert-butyl N-[2,3-dihydro-1H-inden-2-yl-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]carbamate |
| SMILES | CC1Oc2ccc(C(NC(=O)OC(C)(C)C)C3Cc4ccccc4C3)cc2NC1=S |
| InChI | InChI=1S/C24H28N2O3S/c1-14-22(30)25-19-13-17(9-10-20(19)28-14)21(26-23(27)29-24(2,3)4)18-11-15-7-5-6-8-16(15)12-18/h5-10,13-14,18,21H,11-12H2,1-4H3,(H,25,30)(H,26,27) |
| InChIKey | FHQCXLFMNBSNFA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|