C35H42N4O7S — CID 22597506
tert-butyl N-[[3-[[(2-methylpropan-2-yl)oxycarbonyl-[(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]amino]methyl]phenyl]methyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 22597506) has the molecular formula C35H42N4O7S and a molecular weight of 662.81 g/mol. Its IUPAC name is tert-butyl N-[[3-[[(2-methylpropan-2-yl)oxycarbonyl-[(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]amino]methyl]phenyl]methyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[(2-methylpropan-2-yl)oxycarbonyl-[(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]amino]methyl]phenyl]methyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 22597506 |
| Molecular Formula | C35H42N4O7S |
| Molecular Weight | 662.81 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | tert-butyl N-[[3-[[(2-methylpropan-2-yl)oxycarbonyl-[(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)methyl]amino]methyl]phenyl]methyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | CC1Oc2ccc(CN(Cc3cccc(CN(Cc4ccc([N+](=O)[O-])cc4)C(=O)OC(C)(C)C)c3)C(=O)OC(C)(C)C)cc2NC1=S |
| InChI | InChI=1S/C35H42N4O7S/c1-23-31(47)36-29-18-27(13-16-30(29)44-23)22-38(33(41)46-35(5,6)7)21-26-10-8-9-25(17-26)20-37(32(40)45-34(2,3)4)19-24-11-14-28(15-12-24)39(42)43/h8-18,23H,19-22H2,1-7H3,(H,36,47) |
| InChIKey | XCIRDLJWDCFVNL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.81 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|