C25H29ClN2O3 — CID 15429328
tert-butyl N-[(3-chlorophenyl)methyl]-N-[(4-oxo-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-7-yl)methyl]carbamate (PubChem CID 15429328) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is tert-butyl N-[(3-chlorophenyl)methyl]-N-[(4-oxo-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-7-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-chlorophenyl)methyl]-N-[(4-oxo-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-7-yl)methyl]carbamate |
|---|---|
| PubChem CID | 15429328 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | tert-butyl N-[(3-chlorophenyl)methyl]-N-[(4-oxo-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-7-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccc(Cl)c1)Cc1ccc2c(c1)NC(=O)C1CCCC21 |
| InChI | InChI=1S/C25H29ClN2O3/c1-25(2,3)31-24(30)28(14-16-6-4-7-18(26)12-16)15-17-10-11-20-19-8-5-9-21(19)23(29)27-22(20)13-17/h4,6-7,10-13,19,21H,5,8-9,14-15H2,1-3H3,(H,27,29) |
| InChIKey | MXXRSYKSBKOKFT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |