C22H26N2O3S — CID 22623056
tert-butyl N-[1-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)-2-phenylethyl]carbamate (PubChem CID 22623056) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 22623056 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | tert-butyl N-[1-(2-methyl-3-sulfanylidene-4H-1,4-benzoxazin-6-yl)-2-phenylethyl]carbamate |
| SMILES | CC1Oc2ccc(C(Cc3ccccc3)NC(=O)OC(C)(C)C)cc2NC1=S |
| InChI | InChI=1S/C22H26N2O3S/c1-14-20(28)23-18-13-16(10-11-19(18)26-14)17(12-15-8-6-5-7-9-15)24-21(25)27-22(2,3)4/h5-11,13-14,17H,12H2,1-4H3,(H,23,28)(H,24,25) |
| InChIKey | LDPSYRFUIHOQBG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|