C9H16Cl3NO2 — CID 22623631
1-ethylpiperidine;2,2,2-trichloroacetic acid (PubChem CID 22623631) has the molecular formula C9H16Cl3NO2 and a molecular weight of 276.59 g/mol. Its IUPAC name is 1-ethylpiperidine;2,2,2-trichloroacetic acid.
| Compound Name | 1-ethylpiperidine;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 22623631 |
| Molecular Formula | C9H16Cl3NO2 |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 1-ethylpiperidine;2,2,2-trichloroacetic acid |
| SMILES | CCN1CCCCC1.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H15N.C2HCl3O2/c1-2-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h2-7H2,1H3;(H,6,7) |
| InChIKey | UCVILSLIWQLPPJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|