C33H30F3NO3 — CID 22624733
1-[3-(4-methoxyphenyl)-3-[4-methoxy-3-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]piperidine (PubChem CID 22624733) has the molecular formula C33H30F3NO3 and a molecular weight of 545.60 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)-3-[4-methoxy-3-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]piperidine.
| Compound Name | 1-[3-(4-methoxyphenyl)-3-[4-methoxy-3-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]piperidine |
|---|---|
| PubChem CID | 22624733 |
| Molecular Formula | C33H30F3NO3 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)-3-[4-methoxy-3-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]piperidine |
| SMILES | COc1ccc(C2(c3ccc(OC)c(C(F)(F)F)c3)C=Cc3c(cc(N4CCCCC4)c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C33H30F3NO3/c1-38-24-13-10-22(11-14-24)32(23-12-15-30(39-2)28(20-23)33(34,35)36)17-16-27-25-8-4-5-9-26(25)29(21-31(27)40-32)37-18-6-3-7-19-37/h4-5,8-17,20-21H,3,6-7,18-19H2,1-2H3 |
| InChIKey | DWJDJYWWNNZTIF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|