C31H26F3NO4 — CID 11027863
4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]benzo[f]chromen-6-yl]morpholine (PubChem CID 11027863) has the molecular formula C31H26F3NO4 and a molecular weight of 533.55 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]benzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]benzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 11027863 |
| Molecular Formula | C31H26F3NO4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]benzo[f]chromen-6-yl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(OC(F)(F)F)cc3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C31H26F3NO4/c1-36-23-10-6-21(7-11-23)30(22-8-12-24(13-9-22)38-31(32,33)34)15-14-27-25-4-2-3-5-26(25)28(20-29(27)39-30)35-16-18-37-19-17-35/h2-15,20H,16-19H2,1H3 |
| InChIKey | OAFFKZJCCMNLLC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|