C19H18FN3O4 — CID 22632945
6-fluoro-3-hydroxy-1-(4-methoxyphenyl)-7-pyrrolidin-1-ylquinazoline-2,4-dione (PubChem CID 22632945) has the molecular formula C19H18FN3O4 and a molecular weight of 371.37 g/mol. Its IUPAC name is 6-fluoro-3-hydroxy-1-(4-methoxyphenyl)-7-pyrrolidin-1-ylquinazoline-2,4-dione.
| Compound Name | 6-fluoro-3-hydroxy-1-(4-methoxyphenyl)-7-pyrrolidin-1-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22632945 |
| Molecular Formula | C19H18FN3O4 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 6-fluoro-3-hydroxy-1-(4-methoxyphenyl)-7-pyrrolidin-1-ylquinazoline-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)n(O)c(=O)c3cc(F)c(N4CCCC4)cc32)cc1 |
| InChI | InChI=1S/C19H18FN3O4/c1-27-13-6-4-12(5-7-13)22-16-11-17(21-8-2-3-9-21)15(20)10-14(16)18(24)23(26)19(22)25/h4-7,10-11,26H,2-3,8-9H2,1H3 |
| InChIKey | UMGAYVVFQPXCGN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|