C28H27N5O2S — CID 22634228
2-[(2,3-dimethyl-1H-indol-5-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 22634228) has the molecular formula C28H27N5O2S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-1H-indol-5-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[(2,3-dimethyl-1H-indol-5-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22634228 |
| Molecular Formula | C28H27N5O2S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[(2,3-dimethyl-1H-indol-5-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc3nc(NC(=O)Nc4ccc5[nH]c(C)c(C)c5c4)sc3c2)c(C)c1 |
| InChI | InChI=1S/C28H27N5O2S/c1-14-10-15(2)25(16(3)11-14)32-26(34)19-6-8-23-24(12-19)36-28(31-23)33-27(35)30-20-7-9-22-21(13-20)17(4)18(5)29-22/h6-13,29H,1-5H3,(H,32,34)(H2,30,31,33,35) |
| InChIKey | BBOHPBUFDYWAFC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|