C22H24ClN3O3S — CID 57128842
tert-butyl N-chloro-N-[6-[(2,4,6-trimethylphenyl)carbamoyl]-1,3-benzothiazol-2-yl]carbamate (PubChem CID 57128842) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is tert-butyl N-chloro-N-[6-[(2,4,6-trimethylphenyl)carbamoyl]-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-chloro-N-[6-[(2,4,6-trimethylphenyl)carbamoyl]-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 57128842 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | tert-butyl N-chloro-N-[6-[(2,4,6-trimethylphenyl)carbamoyl]-1,3-benzothiazol-2-yl]carbamate |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc3nc(N(Cl)C(=O)OC(C)(C)C)sc3c2)c(C)c1 |
| InChI | InChI=1S/C22H24ClN3O3S/c1-12-9-13(2)18(14(3)10-12)25-19(27)15-7-8-16-17(11-15)30-20(24-16)26(23)21(28)29-22(4,5)6/h7-11H,1-6H3,(H,25,27) |
| InChIKey | CJDPBCMTPNHOLO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|