C19H22N4O3 — CID 22636965
5-[[3,5-diethoxy-4-(furan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 22636965) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[[3,5-diethoxy-4-(furan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3,5-diethoxy-4-(furan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22636965 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[[3,5-diethoxy-4-(furan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCOc1cc(Cc2cnc(N)nc2N)cc(OCC)c1-c1ccco1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-24-15-9-12(8-13-11-22-19(21)23-18(13)20)10-16(25-4-2)17(15)14-6-5-7-26-14/h5-7,9-11H,3-4,8H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | RQGXDWARDWEFOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |