C21H24FN5O2 — CID 22637019
5-[[4-(3-amino-4-fluorophenyl)-3,5-diethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 22637019) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-[[4-(3-amino-4-fluorophenyl)-3,5-diethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-(3-amino-4-fluorophenyl)-3,5-diethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22637019 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 5-[[4-(3-amino-4-fluorophenyl)-3,5-diethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCOc1cc(Cc2cnc(N)nc2N)cc(OCC)c1-c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C21H24FN5O2/c1-3-28-17-8-12(7-14-11-26-21(25)27-20(14)24)9-18(29-4-2)19(17)13-5-6-15(22)16(23)10-13/h5-6,8-11H,3-4,7,23H2,1-2H3,(H4,24,25,26,27) |
| InChIKey | JSPMBIPAEDBTRD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|