C19H20N4O2 — CID 147335866
5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxy-2-phenylphenol (PubChem CID 147335866) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxy-2-phenylphenol.
| Compound Name | 5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxy-2-phenylphenol |
|---|---|
| PubChem CID | 147335866 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxy-2-phenylphenol |
| SMILES | CCOc1cc(Cc2cnc(N)nc2N)cc(O)c1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2/c1-2-25-16-10-12(8-14-11-22-19(21)23-18(14)20)9-15(24)17(16)13-6-4-3-5-7-13/h3-7,9-11,24H,2,8H2,1H3,(H4,20,21,22,23) |
| InChIKey | DCNXHNLURNSPBB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |