C21H26N6O4S — CID 150396989
[2-(3-aminophenyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxyphenyl]methyl-methylsulfamic acid (PubChem CID 150396989) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is [2-(3-aminophenyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxyphenyl]methyl-methylsulfamic acid.
| Compound Name | [2-(3-aminophenyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxyphenyl]methyl-methylsulfamic acid |
|---|---|
| PubChem CID | 150396989 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [2-(3-aminophenyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-ethoxyphenyl]methyl-methylsulfamic acid |
| SMILES | CCOc1cc(Cc2cnc(N)nc2N)cc(CN(C)S(=O)(=O)O)c1-c1cccc(N)c1 |
| InChI | InChI=1S/C21H26N6O4S/c1-3-31-18-9-13(7-15-11-25-21(24)26-20(15)23)8-16(12-27(2)32(28,29)30)19(18)14-5-4-6-17(22)10-14/h4-6,8-11H,3,7,12,22H2,1-2H3,(H,28,29,30)(H4,23,24,25,26) |
| InChIKey | HCYJHIMKMJBSJV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|