C27H34N4O4 — CID 22636972
5-[[3-(cyclopentylmethoxy)-5-ethoxy-4-[4-(methoxymethoxy)phenyl]phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 22636972) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 5-[[3-(cyclopentylmethoxy)-5-ethoxy-4-[4-(methoxymethoxy)phenyl]phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3-(cyclopentylmethoxy)-5-ethoxy-4-[4-(methoxymethoxy)phenyl]phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22636972 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 5-[[3-(cyclopentylmethoxy)-5-ethoxy-4-[4-(methoxymethoxy)phenyl]phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCOc1cc(Cc2cnc(N)nc2N)cc(OCC2CCCC2)c1-c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C27H34N4O4/c1-3-33-23-13-19(12-21-15-30-27(29)31-26(21)28)14-24(34-16-18-6-4-5-7-18)25(23)20-8-10-22(11-9-20)35-17-32-2/h8-11,13-15,18H,3-7,12,16-17H2,1-2H3,(H4,28,29,30,31) |
| InChIKey | NLWWQQJTKVBEMZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|