C11H20F5N — CID 22637491
3-ethyl-N-(1,1,2,2,2-pentafluoroethyl)heptan-1-amine (PubChem CID 22637491) has the molecular formula C11H20F5N and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-ethyl-N-(1,1,2,2,2-pentafluoroethyl)heptan-1-amine.
| Compound Name | 3-ethyl-N-(1,1,2,2,2-pentafluoroethyl)heptan-1-amine |
|---|---|
| PubChem CID | 22637491 |
| Molecular Formula | C11H20F5N |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-ethyl-N-(1,1,2,2,2-pentafluoroethyl)heptan-1-amine |
| SMILES | CCCCC(CC)CCNC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5N/c1-3-5-6-9(4-2)7-8-17-11(15,16)10(12,13)14/h9,17H,3-8H2,1-2H3 |
| InChIKey | SMEXHPXRDRJWPD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|