C19H12ClF3O3 — CID 22638968
6-chloro-8-(2-phenylethynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 22638968) has the molecular formula C19H12ClF3O3 and a molecular weight of 380.75 g/mol. Its IUPAC name is 6-chloro-8-(2-phenylethynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-(2-phenylethynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 22638968 |
| Molecular Formula | C19H12ClF3O3 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 6-chloro-8-(2-phenylethynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(Cl)cc(C#Cc3ccccc3)c2OC1C(F)(F)F |
| InChI | InChI=1S/C19H12ClF3O3/c20-14-8-12(7-6-11-4-2-1-3-5-11)16-13(9-14)10-15(18(24)25)17(26-16)19(21,22)23/h1-5,8-9,15,17H,10H2,(H,24,25) |
| InChIKey | WHZUBKZYNIPAMY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|