C22H16BrCl2N3O4 — CID 22648145
5-bromo-1-(2,6-dichlorophenyl)-3-[(4-methoxyphenyl)methyl]-7-nitro-4H-quinazolin-2-one (PubChem CID 22648145) has the molecular formula C22H16BrCl2N3O4 and a molecular weight of 537.20 g/mol. Its IUPAC name is 5-bromo-1-(2,6-dichlorophenyl)-3-[(4-methoxyphenyl)methyl]-7-nitro-4H-quinazolin-2-one.
| Compound Name | 5-bromo-1-(2,6-dichlorophenyl)-3-[(4-methoxyphenyl)methyl]-7-nitro-4H-quinazolin-2-one |
|---|---|
| PubChem CID | 22648145 |
| Molecular Formula | C22H16BrCl2N3O4 |
| Molecular Weight | 537.20 g/mol |
| Exact Mass | 534.97 |
| IUPAC Name | 5-bromo-1-(2,6-dichlorophenyl)-3-[(4-methoxyphenyl)methyl]-7-nitro-4H-quinazolin-2-one |
| SMILES | COc1ccc(CN2Cc3c(Br)cc([N+](=O)[O-])cc3N(c3c(Cl)cccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H16BrCl2N3O4/c1-32-15-7-5-13(6-8-15)11-26-12-16-17(23)9-14(28(30)31)10-20(16)27(22(26)29)21-18(24)3-2-4-19(21)25/h2-10H,11-12H2,1H3 |
| InChIKey | PYMRJIWRJFJULX-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.20 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|