C16H29N7O6 — CID 22650244
1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 22650244) has the molecular formula C16H29N7O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22650244 |
| Molecular Formula | C16H29N7O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CO)C(=O)NCC(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C16H29N7O6/c17-9(3-1-5-20-16(18)19)13(26)22-10(8-24)14(27)21-7-12(25)23-6-2-4-11(23)15(28)29/h9-11,24H,1-8,17H2,(H,21,27)(H,22,26)(H,28,29)(H4,18,19,20) |
| InChIKey | PECPVMFWFXHSPX-UHFFFAOYSA-N |
| XLogP | -3.96 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|