C18H33N7O5S — CID 18310794
1-[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 18310794) has the molecular formula C18H33N7O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18310794 |
| Molecular Formula | C18H33N7O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 1-[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C18H33N7O5S/c1-31-9-6-11(19)15(27)24-12(4-2-7-22-18(20)21)16(28)23-10-14(26)25-8-3-5-13(25)17(29)30/h11-13H,2-10,19H2,1H3,(H,23,28)(H,24,27)(H,29,30)(H4,20,21,22) |
| InChIKey | NAEZDLXJCIIZQJ-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|