C17H32N8O6 — CID 22655251
5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 22655251) has the molecular formula C17H32N8O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22655251 |
| Molecular Formula | C17H32N8O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)CNC(=O)C(N)CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H32N8O6/c1-8(2)13(25-12(27)7-23-14(28)9(18)6-11(19)26)15(29)24-10(16(30)31)4-3-5-22-17(20)21/h8-10,13H,3-7,18H2,1-2H3,(H2,19,26)(H,23,28)(H,24,29)(H,25,27)(H,30,31)(H4,20,21,22) |
| InChIKey | RGUPOFZUVNQYNH-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|