C14H16ClFN4O2 — CID 22662253
2-[1-(2-fluoro-6-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride (PubChem CID 22662253) has the molecular formula C14H16ClFN4O2 and a molecular weight of 326.76 g/mol. Its IUPAC name is 2-[1-(2-fluoro-6-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride.
| Compound Name | 2-[1-(2-fluoro-6-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 22662253 |
| Molecular Formula | C14H16ClFN4O2 |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[1-(2-fluoro-6-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride |
| SMILES | CC(Nc1c(F)cccc1[N+](=O)[O-])c1cc(N)ccc1N.Cl |
| InChI | InChI=1S/C14H15FN4O2.ClH/c1-8(10-7-9(16)5-6-12(10)17)18-14-11(15)3-2-4-13(14)19(20)21;/h2-8,18H,16-17H2,1H3;1H |
| InChIKey | QPMDJSLMBBBVAP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|