C14H18ClN5O2 — CID 22662399
2-[1-(4-amino-2-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride (PubChem CID 22662399) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-[1-(4-amino-2-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride.
| Compound Name | 2-[1-(4-amino-2-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 22662399 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[1-(4-amino-2-nitroanilino)ethyl]benzene-1,4-diamine;hydrochloride |
| SMILES | CC(Nc1ccc(N)cc1[N+](=O)[O-])c1cc(N)ccc1N.Cl |
| InChI | InChI=1S/C14H17N5O2.ClH/c1-8(11-6-9(15)2-4-12(11)17)18-13-5-3-10(16)7-14(13)19(20)21;/h2-8,18H,15-17H2,1H3;1H |
| InChIKey | YVQSYKPVNOQFNI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 133.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|