C20H19F3N3O5S+ — CID 22663639
[1-[4-(4-nitrophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663639) has the molecular formula C20H19F3N3O5S+ and a molecular weight of 470.45 g/mol. Its IUPAC name is [1-[4-(4-nitrophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(4-nitrophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663639 |
| Molecular Formula | C20H19F3N3O5S+ |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [1-[4-(4-nitrophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | NCC1=C[N+](c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2)(S(=O)(=O)CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C20H19F3N3O5S/c21-20(22,23)14-32(29,30)26(11-1-2-15(12-24)13-26)17-5-9-19(10-6-17)31-18-7-3-16(4-8-18)25(27)28/h1-10,13H,11-12,14,24H2/q+1 |
| InChIKey | BUVWCRJPKOFKGV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|