C21H18FNO3 — CID 22664253
N-[(2,5-dimethoxyphenyl)methyl]-8-fluorodibenzofuran-2-amine (PubChem CID 22664253) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-8-fluorodibenzofuran-2-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-8-fluorodibenzofuran-2-amine |
|---|---|
| PubChem CID | 22664253 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-8-fluorodibenzofuran-2-amine |
| SMILES | COc1ccc(OC)c(CNc2ccc3oc4ccc(F)cc4c3c2)c1 |
| InChI | InChI=1S/C21H18FNO3/c1-24-16-5-8-19(25-2)13(9-16)12-23-15-4-7-21-18(11-15)17-10-14(22)3-6-20(17)26-21/h3-11,23H,12H2,1-2H3 |
| InChIKey | QEAWEOKMSATNAK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |