C21H19NO3 — CID 2981208
N-[(2,4-dimethoxyphenyl)methyl]dibenzofuran-3-amine (PubChem CID 2981208) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]dibenzofuran-3-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 2981208 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]dibenzofuran-3-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)oc2ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H19NO3/c1-23-16-9-7-14(20(12-16)24-2)13-22-15-8-10-18-17-5-3-4-6-19(17)25-21(18)11-15/h3-12,22H,13H2,1-2H3 |
| InChIKey | HWQWBUJIZLGPQG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |