C13H15N3O2S — CID 22669284
1-[4-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-2-yl]-1-methylurea (PubChem CID 22669284) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[4-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-2-yl]-1-methylurea.
| Compound Name | 1-[4-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 22669284 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[4-[2-(4-hydroxyphenyl)ethyl]-1,3-thiazol-2-yl]-1-methylurea |
| SMILES | CN(C(N)=O)c1nc(CCc2ccc(O)cc2)cs1 |
| InChI | InChI=1S/C13H15N3O2S/c1-16(12(14)18)13-15-10(8-19-13)5-2-9-3-6-11(17)7-4-9/h3-4,6-8,17H,2,5H2,1H3,(H2,14,18) |
| InChIKey | BKZZNGLOKFLIKE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |