C13H19NO3 — CID 42638414
4-(4-hydroxyphenyl)butyl N,N-dimethylcarbamate (PubChem CID 42638414) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)butyl N,N-dimethylcarbamate.
| Compound Name | 4-(4-hydroxyphenyl)butyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 42638414 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-(4-hydroxyphenyl)butyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-14(2)13(16)17-10-4-3-5-11-6-8-12(15)9-7-11/h6-9,15H,3-5,10H2,1-2H3 |
| InChIKey | ANRNAWYTOZXFMP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|